Zu "1216468-02-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SB-258585 (hydrochloride)
Artikelnummer: Cay17416-10
SB-258585 is a potent, selective antagonist of the serotonin 5-HT6 receptor (pKi = 8.53). It displays over 100-fold selectivity for 5-HT6 over other 5-HT, dopamine, and alpha-adrenergic receptors. Radiolabeled forms of SB-258585 have been used to evaluate other potential ligands of the 5-HT6 receptor. SB-258585 has...
| Schlagworte: | 4-iodo-N-[4-methoxy-3-(4-methyl-1-piperazinyl)phenyl]-benzenesulfonamide, monohydrochloride |
| Anwendung: | 5-HT6 receptor antagonist |
| CAS | 1216468-02-8 |
| MW: | 523.8 D |
ab 49,00 €
SB 258585 hydrochloride
Artikelnummer: TGM-T23318-10mg
Description: SB 258585 hydrochloride is a 5-HT6 receptor antagonist. Target: Others. Smiles: Cl.O=S(=O)(NC1=CC=C(OC)C(=C1)N2CCN(C)CC2)C3=CC=C(I)C=C3
| Anwendung: | 5-HT6 receptor antagonist |
| CAS | 1216468-02-8 |
| MW: | 523.82 D |
ab 106,00 €
