Zu "121264-04-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
ICI 204448 (hydrochloride)
Artikelnummer: Cay45206-1
ICI 204448 is a kappa-opioid receptor agonist. It binds to the kappa-opioid receptor (Ki = 2.69 nM) and is 162- and 69-fold selective for the kappa-opioid receptor over the µ- and delta-opioid receptors in membranes prepared from cells expressing the human kappa-, µ- and delta-opioid receptors, repectively. ICI...
| Schlagworte: | 2-[3-[1-[[2-(3,4-dichlorophenyl)acetyl]methylamino]-2-(1-pyrrolidinyl)ethyl]phenoxy]-acetic acid, monohydrochloride |
| Anwendung: | Kappa-opioid receptor agonist |
| CAS | 121264-04-8 |
| MW: | 501.83 D |
ab 39,00 €
ICI 204,448
Artikelnummer: TGM-T22850-10mg
Description: ICI 204,448 is a potent kappa-opioid agonist with potential analgesic activity for the study of neurological diseases. Target: Opioid Receptor. Smiles: Cl.O=C(O)COC1=CC=CC(=C1)C(N(C(=O)CC2=CC=C(Cl)C(Cl)=C2)C)CN3CCCC3. References: J S Shaw, et, al. ICI 204448: a kappa-opioid agonist with limited access...
| Schlagworte: | ICI-204448, ICI 204448, ICI204448 |
| CAS | 121264-04-8 |
| MW: | 501.83 D |
ab 33,00 €
