Zu "121034-89-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
IEM 1460
Artikelnummer: Cay15623-10
IEM 1460 is an adamantine derivative that blocks both AMPA- and NMDA-type glutamate receptor (GluR) channels (IC50 = 10 µM-0.1 mM). It is selective for Ca2+-permeable GluR channels, which lack the GluR2 R subunit, and has been used to identify Ca2+-permeable glutamate receptors in the brain.Formal Name:...
| Schlagworte: | N,N,N-trimethyl-5-[(tricyclo[3.3.1.13,7]dec-1-ylmethyl)amino]-1-pentanaminium, bromide, hydrobromide |
| Anwendung: | Ca2+-permeable GluR channel blocker |
| CAS | 121034-89-7 |
| MW: | 454.3 D |
ab 164,00 €
IEM 1460
Artikelnummer: TGM-T22854-10mg
Description: AMPA receptors blocker. Target: Others. Smiles: [Br-].Br.N(CCCCC[N+](C)(C)C)CC12CC3CC(CC(C3)C1)C2
| CAS | 121034-89-7 |
| MW: | 454.33 D |
ab 361,00 €
