Zu "1208549-68-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CAY10640
Artikelnummer: Cay10642-1
Soluble epoxide hydrolase (sEH) inhibitors have important therapeutic use by increasing the in vivo concentration of EETs and other fatty acid epoxides, resulting in anti-inflammatory, antihypertensive, neuroprotective, and cardioprotective effects. CAY10640 is a 1-aryl-3-(1-acylpiperidin-4-yl)urea analog that...
| Schlagworte: | sEHi, Soluble Epoxide Hydrolase Inhibitor, N-[1-(cyclopropylcarbonyl)-4-piperidinyl]-N'-[4-(trifluoromethoxy)phenyl]-urea |
| Anwendung: | Soluble epoxide hydrolase (sEH) inhibitor |
| CAS | 1208549-68-1 |
| MW: | 371.4 D |
ab 81,00 €
CAY10640
Artikelnummer: TGM-T38367-100mg
Description: CAY10640 (sEH inhibitor-1) is a potent, orally active, water-soluble epoxide hydrolase (sEH) inhibitor that inhibits sEH in humans and mice with IC50s of 0.4 and 5.3 nM, respectively. Target: Epoxide Hydrolase. Smiles: C(=O)(C1CC1)N2CCC(NC(NC3=CC=C(OC(F)(F)F)C=C3)=O)CC2
| Schlagworte: | sEH inhibitor-1 |
| Anwendung: | Soluble epoxide hydrolase (sEH) inhibitor |
| CAS | 1208549-68-1 |
| MW: | 371.35 D |
ab 118,00 €
