Zu "1205679-02-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Hexapeptide-3
Artikelnummer: TGM-T82205-50mg
Description: Hexapeptide-3 is a bioactive peptide known for its skin-repairing effects and is documented as a cosmetic ingredient [1]. Smiles: [C@H](C(N[C@H](C(N[C@@H](CCCNC(=N)N)C(N)=O)=O)CCCNC(=N)N)=O)(NC([C@@H](NC([C@@H](NC([C@H](CCC(O)=O)N)=O)CCC(O)=O)=O)CCSC)=O)CCC(N)=O
| CAS | 1205679-02-2 |
| MW: | 846.96 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Hexapeptide-3
Artikelnummer: CSB-DT1744.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | H-Glu-Glu-Met-Gln-Arg-Arg-NH2, H-EEMQRR-NH2 |
| Anwendung: | Cosmetic peptide |
| CAS | 1205679-02-2 |
| MW: | 847 D |
210,00 €
