Zu "1202757-89-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AVL-292
Artikelnummer: LKT-A8644.25
AVL-292 is a Bruton's tyrosine kinase (BTK) inhibitor that exhibits anticancer chemotherapeutic activities. AVL-292 is in clinical development as a potential treatment for B-cell-related disorders such as chronic lymphocytic leukemia (CLL).
| Schlagworte: | CC-292 |
| Anwendung: | BTK inhibitor |
| CAS | 1202757-89-8 |
| MW: | 423.44 D |
ab 95,00 €
AVL-292
Artikelnummer: Cay17993-1
AVL-292 is a covalent inhibitor of Bruton's tyrosine kinase (BTK, IC50 = 5.9 nM). It is selective for BTK over a panel of 61 kinases when used at a concentration of 1 µM but does inhibit the additional Tec family kinases BMX, Itk, Tec, and TXK (IC50s = 0.7, 36, 6.2, and 8.9 nM, respectively). AVL-292 inhibits naïve...
| Schlagworte: | CC-292, Spebrutinib, N-[3-[[5-fluoro-2-[[4-(2-methoxyethoxy)phenyl]amino]-4-pyrimidinyl]amino]phenyl]-2-propenamide |
| Anwendung: | BTK inhibitor |
| CAS | 1202757-89-8 |
| MW: | 423.4 D |
ab 61,00 €
Spebrutinib
Artikelnummer: TGM-T2603-100mg
Description: Spebrutinib (LMK-435) is an orally bioavailable, selective inhibitor of Bruton's agammaglobulinemia tyrosine kinase (BTK), with potential antineoplastic activity. Target: Src, BTK. Smiles: COCCOc1ccc(Nc2ncc(F)c(Nc3cccc(NC(=O)C=C)c3)n2)cc1. References: Evans E, et al. ASH Annual Meeting, 2011 San Diego,...
| Schlagworte: | AVL-292, LMK-435, CC-292 |
| Anwendung: | Targets Bruton agammaglobulinemia tyrosine kinase [EC:2.7.10.2] (BTK) |
| CAS | 1202757-89-8 |
| MW: | 423.44 D |
ab 37,00 €
