Zu "1194506-26-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fruquintinib
Artikelnummer: Cay29425-10
Fruquintinib is a VEGFR inhibitor (IC50s = 33, 35, and 0.5 nM for VEGFR1, -2, and -3, respectively). It also inhibits RET, FGFR1, and c-Kit (IC50s = 128, 181, and 458 nM, respectively) in a panel of 253 kinases. Fruquintinib inhibits VEGF-A-induced proliferation of human umbilical vein endothelial cells (HUVECs) and...
| Schlagworte: | HMPL-013, 6-[(6,7-dimethoxy-4-quinazolinyl)oxy]-N,2-dimethyl-3-benzofurancarboxamide |
| Anwendung: | VEGFR inhibitor |
| CAS | 1194506-26-7 |
| MW: | 393.4 D |
ab 75,00 €
Fruquintinib
Artikelnummer: TGM-T2656-100mg
Description: Fruquintinib (HMPL-013) is an orally available, small molecule inhibitor of vascular endothelial growth factor receptors (VEGFRs), with potential anti-angiogenic and antineoplastic activities. Target: VEGFR. Smiles: CNC(=O)c1c(C)oc2cc(Oc3ncnc4cc(OC)c(OC)cc34)ccc12. References: Gu Y, et al. Y ChemOthers...
| Schlagworte: | HMPL-013 |
| CAS | 1194506-26-7 |
| MW: | 393.39 D |
ab 30,00 €
