Zu "1193383-09-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
JNJ-42041935
Artikelnummer: TGM-T3180-100mg
Description: JNJ-42041935 (HIF-PHD Inhibitor II) is a potent (pKi = 7.3-7.9), 2-oxoglutarate competitive, reversible, and selective inhibitor of PHD enzymes. Target: HIF/HIF Prolyl-Hydroxylase. Smiles: OC(=O)c1cnn(c1)-c1nc2cc(Cl)c(OC(F)(F)F)cc2[nH]1. References: Barrett TD, et al. Pharmacological characterization of...
| Schlagworte: | HIF-PHD Inhibitor II |
| Anwendung: | HIF-PH4 inhibitor |
| CAS | 1193383-09-3 |
| MW: | 346.65 D |
ab 34,00 €
JNJ-42041935
Artikelnummer: Cay14316-5
JNJ-42041935 is a selective, 2-OG competitive, and reversible inhibitor of HIF-PH enzymes (pKis = 12.3, 51.3, and 22.4 nM for HIF-PH1, HIF-PH2, and HIF-PH3, respectively). It is >100-fold selective for HIF-PH compared to the related FIH (factor-inhibiting HIF) and a panel of various other enzymes. In an...
| Schlagworte: | HIF-PHD Inhibitor II, 1-[6-chloro-5-(trifluoromethoxy)-1H-benzimidazol-2-yl]-1H-pyrazole-4-carboxylic acid |
| Anwendung: | HIF-PH4 inhibitor |
| CAS | 1193383-09-3 |
| MW: | 346.7 D |
ab 85,00 €
