Zu "1189482-35-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Furosemide-d5
Artikelnummer: Cay31789-1
Furosemide-d5 is intended for use as an internal standard for the quantification of furosemide (Cay-17273) by GC- or LC-MS. Furosemide is a loop diuretic and an inhibitor of the Na+/K+/2Cl- (NKCC) cotransporters, NKCC1 and NKCC2 (Kis = ~10 µM for both). In vivo, furosemide (0.1 mg/kg, p.o.) increases diuresis in...
| Schlagworte: | Frusemide-d5, 4-chloro-2-(((furan-2-yl-d3)methyl-d2)amino)-5-sulfamoylbenzoic acid |
| Anwendung: | GC-MS, LC-MS, quantification, internal standard, NKCC inhibitor |
| CAS | 1189482-35-6 |
| MW: | 335.8 D |
489,00 €
Furosemide-d5
Artikelnummer: TGM-TMIH-0248-10mg
Description: Furosemide-d5 is a deuterated compound of Furosemide. Smiles: [2H]C1=C([2H])C([2H])=C(O1)C([2H])([2H])NC1=C(C=C(C(Cl)=C1)S(N)(=O)=O)C(O)=O
| Anwendung: | GC-MS, LC-MS, quantification, internal standard, NKCC inhibitor |
| CAS | 1189482-35-6 |
| MW: | 335.78 D |
ab 358,00 €
