Zu "1187431-43-1" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Trametinib (DMSO solvate)
Trametinib (DMSO solvate)

Artikelnummer: Cay44750-10

Trametinib is an inhibitor of MEK1 and -2. It inhibits B-RAF- and C-RAF-induced phosphorylation of MEK1 (IC50s = 3. and 1. nM, respectively) and MEK2 (IC50s = 1. and 0. nM, respectively). Trametinib inhibits the growth of two human colorectal cancer cell lines expressing mutant B-RAF (IC50s = 0. and 0. nM) and seven...
Schlagworte: GSK1120212, JTP-74057,...
Anwendung: MEK1/MEK2 inhibitor
CAS 1187431-43-1
MW: 693.53 D
ab 34,00 €
Bewerten
Trametinib (DMSO solvate)
Trametinib (DMSO solvate)

Artikelnummer: TGM-T5857-100mg

Description: Trametinib (DMSO solvate) (GSK-1120212 (DMSO solvate)) is a highly potent and selective MEK inhibitor that specifically inhibits MEK1/2 (IC50: 2 nM). Target: Apoptosis, MEK. Smiles: CS(C)=O.CC(=O)Nc1cccc(c1)-n1c2c(C)c(=O)n(C)c(Nc3ccc(I)cc3F)c2c(=O)n(C2CC2)c1=O. References: Abe H , Kikuchi S , Hayakawa...
Schlagworte: Trametinib DMSO solvate, GSK-1120212 (DMSO solvate), JTP-74057 (DMSO solvate), Trametinib dimethyl sulfoxide
Anwendung: Targets mitogen-activated protein kinase kinase 1 [EC:2.7.12.2] (MAP2K1, MEK1)
CAS 1187431-43-1
MW: 693.53 D
ab 39,00 €
Bewerten