Zu "1186195-60-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
MTEP hydrochloride
Artikelnummer: TGM-T7515-100mg
Description: MTEP hydrochloride (MTEP) is non-competitive mGlu5 antagonist (IC50 and Ki of 5 nM and 16 nM, respectively). Target: GluR. Smiles: Cl.Cc1nc(cs1)C#Cc1cccnc1. References: NMDA but not AMPA glutamatergic receptors are involved in the antidepressant-like activity of MTEP during the forced swim test in...
| Schlagworte: | 3-((2-Methyl-1,3-thiazol-4-yl)ethyn-yl)pyridine hydrochloride, MTEP |
| Anwendung: | mGlu5a receptor antagonist |
| CAS | 1186195-60-7 |
| MW: | 236.72 D |
ab 37,00 €
MTEP (hydrochloride)
Artikelnummer: Cay14961-10
Glutamate, the major excitatory neurotransmitter in the brain, acts on both ionotropic and metabotropic glutamate receptors. Excessive metabotropic glutamate receptor (mGluR) transmission has been linked to epilepsy, ischemia, pain, anxiety, and depression. Eight subtypes (1-8) and multiple splice variants of the...
| Schlagworte: | 3-[2-(2-methyl-4-thiazolyl)ethynyl]-pyridine, monohydrochloride |
| Anwendung: | mGlu5a receptor antagonist |
| CAS | 1186195-60-7 |
| MW: | 236.7 D |
ab 45,00 €
