Zu "1185851-52-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tafluprost ethyl amide
Artikelnummer: Cay9000843-1
Tafluprost ethyl amide is a derivative of the tafluoprost (free acid) prodrug tafluprost (Cay-10005440). Formulations containing tafluprost ethyl amide have been used in the treatment of eyelash hypotrichosis and in cosmetics.Formal Name:...
| Schlagworte: | Dechloro Dehydroxy Difluoro Ethylcloprostenolamide,... |
| Anwendung: | FP receptor agonist |
| CAS | 1185851-52-8 |
| MW: | 437.5 D |
ab 153,00 €
Tafluprost ethyl amide
Artikelnummer: TGM-T37956-10mg
Description: Tafluprost ethyl amide, a prostaglandin derivative, reduces intraocular pressure (IOP) and affects eyelash growth, making it suitable for use in anti-glaucoma eye drops and cosmetics. Target: Others. Smiles: C(=C/C(COC1=CC=CC=C1)(F)F)\[C@@H]2[C@@H](C/C=C\CCCC(NCC)=O)[C@@H](O)C[C@H]2O
| CAS | 1185851-52-8 |
| MW: | 437.52 D |
ab 345,00 €
