Zu "1173900-33-8" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AZD 6482
Artikelnummer: Cay15250-1
Phosphatidylinositol 3-kinase (PI3K) catalyzes the phosphorylation of the 3' hydroxyl position of PIs to produce the second messengers PtdIns-(3,4)-P2 and PtdIns-(3,4,5)-P3. PI3Kalpha, beta, and delta are class 1A enzymes composed of p110 and p85 subunits, whereas PI3Kgamma is a class 1B PI3K composed of a p110...
| Schlagworte: | KIN-193, 2-[[(1R)-1-[7-methyl-2-(4-morpholinyl)-4-oxo-4H-pyrido[1,2-a]pyrimidin-9-yl]ethyl]amino]-benzoic acid |
| Anwendung: | PI3K inhibitor |
| CAS | 1173900-33-8 |
| MW: | 408.5 D |
ab 51,00 €
AZD6482
Artikelnummer: LKT-A9712.1
AZD-6482 is an inhibitor of p110 PI3K. AZD-6482 inhibits insulin-induced adipocyte glucose uptake in vitro and increases glucose homeostasis in vivo. Additionally, AZD-6482 exhibits antithrombotic activity without increasing bleeding time or blood loss in other animal models.
| Anwendung: | PI3K p110 inhibitor |
| CAS | 1173900-33-8 |
| MW: | 408.45 D |
ab 152,00 €
AZD 6482
Artikelnummer: TGM-T6087-100mg
Description: AZD 6482 (AZD6482) is a potent and selective p110beta inhibitor with IC50 of 0.69 nM and a PI3Kbeta inhibitor with IC50 of 10 nM. Target: DNA-PK, PI3K, Autophagy. Smiles: C[C@@H](Nc1ccccc1C(O)=O)c1cc(C)cn2c1nc(cc2=O)N1CCOCC1. References: Fjellstrom O, et al. US Patent, WO2009093972.
| Schlagworte: | AZD6482, KIN 193 |
| Anwendung: | PI3K inhibitor |
| CAS | 1173900-33-8 |
| MW: | 408.45 D |
ab 30,00 €
