Zu "1164153-22-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR 3576
Artikelnummer: Cay20215-1
SR 3576 is a JNK3 inhibitor (IC50 = 7 nM). It is selective for JNK3 over JNK1 and p38 MAP kinase (IC50s = 0.17 and >20 µM, respectively). It inhibits c-Jun phosphorylation in INS-1 cells (IC50 = 1.3 µM).Formal Name: 3-[4-[[[(3-methylphenyl)amino]carbonyl]amino]-1H-pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)-benzamide....
| Schlagworte: | 3-[4-[[[(3-methylphenyl)amino]carbonyl]amino]-1H-pyrazol-1-yl]-N-(3,4,5-trimethoxyphenyl)-benzamide |
| Anwendung: | JNK3 inhibitor |
| CAS | 1164153-22-3 |
| MW: | 501.5 D |
ab 49,00 €
SR 3576
Artikelnummer: TGM-T23392-1mg
Description: JNK3 inhibitor, potent and selective. Target: Others. Smiles: N(C(NC1=CC(C)=CC=C1)=O)C2=CN(N=C2)C3=CC(C(NC4=CC(OC)=C(OC)C(OC)=C4)=O)=CC=C3
| Anwendung: | JNK3 inhibitor |
| CAS | 1164153-22-3 |
| MW: | 501.53 D |
ab 106,00 €
