Zu "115532-52-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TMRE (Tetramethylrhodamine ethyl ester)
Artikelnummer: ABD-22220
Like JC-1, TMRM and TMRE are widely used for measuring mitochondrial membrane potential besides their selective mitochondrial staining. TMRE is slightly more hydrophobic than TMRM.
| Anwendung: | Mitochondrial membrane potential assays |
| CAS | 115532-52-0 |
139,00 €
TMRE
Artikelnummer: TGM-T19072-10mg
Description: TMRE (Tetramethylrhodamine ethyl ester perchlorate) is a mitochondria specific dye (lambdaex: 550 nm, lambdaem: 575 nm). Target: Others. Smiles: [O-][Cl](=O)(=O)=O.CCOC(=O)c1ccccc1-c1c2ccc(cc2[o+]c2cc(ccc12)N(C)C)N(C)C. References: Crowley LC, et al. Measuring Mitochondrial Transmembrane Potential by...
| Schlagworte: | Tetramethylrhodamine ethyl ester perchlorate |
| CAS | 115532-52-0 |
| MW: | 514.95 D |
ab 42,00 €
Tetramethylrhodamine ethyl ester (perchlorate)
Artikelnummer: Cay21426-10
Tetramethylrhodamine ethyl ester (TMRE) (perchlorate) is a non-cytotoxic cell-permeant fluorogenic dye most commonly used to assess mitochondrial function using live cell fluorescence microscopy and flow cytometry. It displays excitation/emission spectra of 550/575 nm, respectively. Due to the polarization of the...
| Schlagworte: | TMR ethyl ester, TMRE, 3,6-bis(dimethylamino)-9-[2-(ethoxycarbonyl)phenyl]-xanthylium, perchlorate |
| Anwendung: | FC, live cell fluorescence, ICC, mitochondrial function testing |
| CAS | 115532-52-0 |
| MW: | 515 D |
ab 52,00 €
