Zu "1155-40-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
3,5-Diiodothyroacetic Acid
Artikelnummer: Cay22108-10
3,5-Diiodothyroacetic acid is an acetic acid derivative of thyroxine (Cay-14116). It inhibits copper-induced lipid peroxidation of LDL isolated from human plasma when used at a concentration of 1 µM. 3,5-Diiodothyroacetic acid (5 mg/100 g diet) increases urinary and fecal excretion of sterols, as well as prevents...
| Schlagworte: | Diac, NSC 90463, 4-(4-hydroxyphenoxy)-3,5-diiodo-benzeneacetic acid |
| Anwendung: | Calorigenic |
| CAS | 1155-40-4 |
| MW: | 496 D |
ab 105,00 €
3,5-Diiodothyroacetic Acid
Artikelnummer: TGM-T35999-100mg
Description: 3,5-Diiodothyroacetic acid is a thyroid hormone analog known to reduce cholesterol concentrations and is potentially useful in the study of hypothyroidism. Target: Others. Smiles: OC(=O)Cc1cc(I)c(Oc2ccc(O)cc2)c(I)c1
| CAS | 1155-40-4 |
| MW: | 496.039 D |
ab 232,00 €
