Zu "1150153-86-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SR 16584
Artikelnummer: Cay10683-1
Nicotinic acetylcholine receptors (nAChRs) are ligand-gated ion channels in the central and peripheral nervous system. SR 16584 is an antagonist of the alpha3beta4 nAChR subtype (IC50 = 10.2 µM). It shows selective binding of the alpha3beta4 subtype compared to the alpha4beta2 and alpha7 subtypes (Ki values of...
| Schlagworte: | 3-dihydro-1-(9-methyl-9-azabicyclo[3.3.1]non-3-yl)-2H-indol-2-one |
| Anwendung: | alpha3beta4 nAChR antagonist |
| CAS | 1150153-86-8 |
| MW: | 270.4 D |
ab 45,00 €
SR 16584
Artikelnummer: TGM-T23388-10mg
Description: alpha3beta4 nAChR antagonist. Target: Others. Smiles: O=C1N(C=2C(C1)=CC=CC2)[C@@H]3C[C@@]4(N(C)[C@](C3)(CCC4)[H])[H]. References: Solt L A, Kumar N, He Y, et al. Identification of a selective RORgamma ligand that suppresses Th17 cells and stimulates T regulatory cells[J]. ACS chemical biology, 2012,...
| CAS | 1150153-86-8 |
| MW: | 270.37 D |
ab 83,00 €
