Zu "1149-99-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Illudin S
Artikelnummer: Cay17451-1
Illudins are fungal sesquiterpenes that, through their unique DNA alkylating actions, have anticancer potential. Illudin S is a cytotoxic illudin that is converted, intracellularly, to metabolites that cause a complete block of cell cycling at the G1-S phase interface, particularly in myeloid and T-lymphocyte...
| Schlagworte: | Lampterol, NSC 400979, NSC 626369,... |
| Anwendung: | DNA alkylating agent |
| CAS | 1149-99-1 |
| MW: | 264.3 D |
ab 465,00 €
Illudin S
Artikelnummer: TGM-T22857-10mg
Description: Illudin S (ILS) is a fungal sesquiterpene secondary metabolite with potent genotoxic and cytotoxic properties. Target: Apoptosis, Antifungal, DNA Alkylator/Crosslinker. Smiles: CC1=C2[C@@H](O)[C@](C)(CO)C=C2C(=O)[C@](C)(O)C11CC1. References: Lisa Casimir, et al.The mutational impact of Illudin S on...
| CAS | 1149-99-1 |
| MW: | 264.32 D |
ab 148,00 €
