Zu "1143573-33-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
CAY10599
Artikelnummer: TGM-T37830-10mg
Description: CAY10599 has a wide range of applications in life science related research. Target: Others. Smiles: CCCc1cc(ccc1OCCCN1CCCc2c(OC(C)(C)C(O)=O)cccc12)C(=O)c1ccc(cc1)-c1ccccc1
| Anwendung: | PPARgamma agonist |
| CAS | 1143573-33-4 |
| MW: | 591.748 D |
ab 150,00 €
CAY10599
Artikelnummer: Cay13282-1
CAY10599 is an agonist of peroxisome proliferator-activated receptor gamma (PPARgamma, EC50 = 0.05 µM in a transactivation assay). It is selective for PPARgamma over PPARalpha and PPARdelta (EC50s = 3.99 and >10 µM, respectively, in transactivation assays).Formal Name:...
| Schlagworte: | 2-[[1-[3-[4-([1,1'-biphenyl]-4-ylcarbonyl)-2-propylphenoxy]propyl]-1,2,3,4-tetrahydro-5-quinolinyl]oxy]-2-methyl-propanoic... |
| Anwendung: | PPARgamma agonist |
| CAS | 1143573-33-4 |
| MW: | 591.7 D |
ab 69,00 €
