Zu "1139-83-9" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Urolithin B
Urolithin B

Artikelnummer: LKT-U698576.10

Urolithins are microflora metabolites of dietary ellagic acid derivatives, such as ellagitannins. SMILES: C1=CC=C2C(=C1)C3=C(C=C(C=C3)O)OC2=O
Schlagworte: 3-hydroxybenzo[c]chromen-6-one
Anwendung: Ellagic acid derivative produced by gut microflora
CAS 1139-83-9
MW: 212.2 D
ab 109,00 €
Bewerten
Urolithin B
Urolithin B

Artikelnummer: Cay33757-1

Urolithin B is a metabolite of the polyphenolic antioxidant ellagic acid (Cay-10569) that has diverse biological activities. It is formed from ellagic acid via several intermediates by gut microbiota. Urolithin B reduces the levels of advanced glycation end products (AGEs) in a cell-free assay in a...
Schlagworte: 3-hydroxy Urolithin, NSC 94726, 3-hydroxy-6H-dibenzo[b,d]pyran-6-one
Anwendung: Ellagic acid metabolite
CAS 1139-83-9
MW: 212.2 D
ab 139,00 €
Bewerten