Zu "113852-37-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Cidofovir
Artikelnummer: TGM-T6244-100mg
Description: Cidofovir ((S)-HPMPC) inhibits virus replication by specific inhibition of viral DNA synthesis. Target: DNA/RNA Synthesis, Others. Smiles: Nc1ccn(C[C@@H](CO)OCP(O)(O)=O)c(=O)n1. References: Snoeck R, et al, Antimicrob Agents Chemother, 1988, 32(12), 1839-1844.
| Schlagworte: | (S)-HPMPC, GS 0504, HPMPC |
| CAS | 113852-37-2 |
| MW: | 279.19 D |
ab 31,00 €
Cidofovir
Artikelnummer: Cay13113-25
Cidofovir is an acyclic nucleoside phosphonate antiviral agent and an active metabolite of brincidofovir (Cay-35062). It is formed from brincidofovir in MRC-5 human lung fibroblasts. Cidofovir inhibits CMV DNA synthesis in a cell-free assay, as well as replication of two CMV strains in plaque formation assays (IC50s...
| Schlagworte: | GS-0504, HPMPC, Vistide, P-[[(1S)-2-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1-(hydroxymethyl)ethoxy]methyl]-phosphonic acid |
| Anwendung: | Nucleoside phosphonate, antiviral agent |
| CAS | 113852-37-2 |
| MW: | 279.2 D |
ab 52,00 €
