Zu "112529-15-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pioglitazone hydrochloride
Artikelnummer: TGM-T0214L-100mg
Description: Pioglitazone hydrochloride (AD 4833) is the hydrochloride salt of an orally-active thiazolidinedione with antidiabetic properties and potential antineoplastic activity. Target: Ferroptosis, PPAR. Smiles: Cl.CCc1ccc(CCOc2ccc(CC3SC(=O)NC3=O)cc2)nc1. References: Xing B, et al. J Neuroinflammation,2008, 5, 4.
| Schlagworte: | Pioglitazone HCl, U 72107A, AD 4833, U-72107E |
| CAS | 112529-15-4 |
| MW: | 392.9 D |
ab 37,00 €
Pioglitazone HCl
Artikelnummer: LKT-P6954.1
Orally active antihyperglycemic agent effective as treatment of non-insulin-dependent diabetes mellitus. It inhibits cholesterol absorption and shows anti-inflammatory and anti-arterioscleortic effects.
| Schlagworte: | Pioglitazone hydrochloride |
| Anwendung: | PPAR gamma agonist |
| CAS | 112529-15-4 |
| MW: | 392,91 D |
ab 87,00 €
Pioglitazone (hydrochloride)
Artikelnummer: Cay22263-500
Pioglitazone is an agonist of the peroxisome proliferator-activated receptor gamma (PPARgamma, EC50 = ~500-600 nM for both human and murine PPARgamma). It is selective for PPARgamma over PPARalpha, exhibiting low level activation of PPARalpha at 1 µM and 5.4-fold activation at a concentration of 10 µM. Pioglitazone...
| Schlagworte: | 5-[[4-[2-(5-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-2,4-thiazolidinedione, monohydrochloride |
| Anwendung: | Selective PPARgamma-1 agonist |
| CAS | 112529-15-4 |
| MW: | 392.9 D |
ab 133,00 €
