Zu "1113-83-3" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
N-Glycolylneuraminic Acid
N-Glycolylneuraminic Acid

Artikelnummer: Cay30283-10

N-Glycolylneuraminic acid (Neu5Gc) is a sialic acid that is found in non-human primate tissues. It is not endogenously produced in humans due to a mutation in the gene that encodes CMP-Neu5Ac hydroxylase, the enzyme that hydrolyzes N-acetylneuraminic acid to form Neu5Gc, but accumulates in human cells after...
Schlagworte: Neu5Gc, N-glycolyl-Neuraminic Acid, N-(2-hydroxyacetyl)-neuraminic acid
Anwendung: Sialic acid, CMAH product
CAS 1113-83-3
MW: 325.3 D
ab 93,00 €
Bewerten
N-Glycolylneuraminic acid
N-Glycolylneuraminic acid

Artikelnummer: TGM-T19456-100mg

Description: N-Glycolylneuraminic acid (GcNeu) is a nonhuman sialic acid molecule synthesized in pigs. N-Glycolylneuraminic acid is a receptor of human and animal IAVs. Target: Influenza Virus, Endogenous Metabolite. Smiles: OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O. References: Takahashi...
Schlagworte: NeuGc, GcNeu
Anwendung: Sialic acid, CMAH product
CAS 1113-83-3
MW: 325.27 D
ab 34,00 €
Bewerten