Zu "1111556-37-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Takinib
Artikelnummer: Cay24161-5
Takinib is a TGF-beta-activated kinase 1 (TAK1) inhibitor (IC50 = 9.5 nM). It is selective for TAK1 over IRAK1, IRAK4, GCK, Clk2, and MINK1 (IC50s = 390, 120, 430, 430, and 1,900 nM, respectively). Takinib increases caspase-3/-7 activity and inhibits proliferation of TNF-alpha-stimulated, but not unstimulated,...
| Schlagworte: | N1-(1-propyl-1H-benzimidazol-2-yl)-1,3-benzenedicarboxamide |
| Anwendung: | TAK1 (MAP3K7) inhibitor |
| CAS | 1111556-37-6 |
| MW: | 322.4 D |
ab 49,00 €
Takinib
Artikelnummer: TGM-T4264-10mg
Description: Takinib (EDHS-206) is a specific and effective TAK1 inhibitor(IC50= 9.5 nM). Target: MAPK, Apoptosis. Smiles: CCCn1c(NC(=O)c2cccc(c2)C(N)=O)nc2ccccc12. References: Totzke J, et al. Takinib, a Selective TAK1 Inhibitor, Broadens the Therapeutic Efficacy of TNF-alpha Inhibition for Cancer and Autoimmune...
| Schlagworte: | EDHS-206 |
| Anwendung: | TAK1 (MAP3K7) inhibitor |
| CAS | 1111556-37-6 |
| MW: | 322.36 D |
ab 62,00 €
