Zu "1103926-82-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TM5275
Artikelnummer: Cay23151-1
TM5275 is an inhibitor of plasminogen activator inhibitor 1 (PAI-1, IC50 = 6.95 µM), a serine-protease inhibitor involved in thrombosis. TM5275 inhibits formation of a complex consisting of tissue plasminogen activator (tPA), PAI-1, and GFP on vascular endothelial cells (VECs) in vitro, prolonging the time that tPA...
| Schlagworte: | 5-chloro-2-[[2-[2-[4-(diphenylmethyl)-1-piperazinyl]-2-oxoethoxy]acetyl]amino]-benzoic acid, monosodium salt |
| Anwendung: | PAI-1 inhibitor |
| CAS | 1103926-82-4 |
| MW: | 544 D |
ab 53,00 €
TM5275 sodium
Artikelnummer: TGM-T4255-100mg
Description: TM5275 sodium (TM5275 sodium salt) is an inhibitor of plasminogen activator inhibitor 1 (PAI-1). Target: PAI-1. Smiles: [Na+].[O-]C(=O)c1cc(Cl)ccc1NC(=O)COCC(=O)N1CCN(CC1)C(c1ccccc1)c1ccccc1. References: Izuhara Y, et al. A novel inhibitor of plasminogen activator inhibitor-1 provides antithrombotic...
| Schlagworte: | TM5275 sodium salt |
| Anwendung: | PAI-1 inhibitor |
| CAS | 1103926-82-4 |
| MW: | 543.98 D |
ab 34,00 €
