Zu "1095588-70-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
10,11-Dehydrocurvularin
Artikelnummer: AG-CN2-0165-M001
Isolated from Aspergillus sp. Antibiotic. Antifungal. Nematicidal. Phytotoxic. TGF-beta signaling inhibitor. Anticancer compound. Strong activator of the heat shock response. Inhibitor of the appressorium formation of M. grisea
| Schlagworte: | alpha,beta-Dehydrocurvularin |
| Anwendung: | Heat shock response activator |
| CAS | 1095588-70-7 |
| MW: | 290,3 D |
ab 121,00 €
10,11-Dehydrocurvularin
Artikelnummer: LKT-D170310.1
| Schlagworte: | alpha,beta-Dehydrocurvularin, Dehydrocurvularin, Trans-Dehydrocurvularin, AC1O5P3Y, Dehydrocurvularin |
| Anwendung: | Fungal metabolite |
| CAS | 1095588-70-7 |
| MW: | 290.32 D |
ab 184,00 €
(R)-10,11-Dehydrocurvularin
Artikelnummer: TGM-T10034-25mg
Description: 10,11-Dehydrocurvularin is an antibiotic and a strong activator of the heat shock response. It inhibits the TGF-beta signaling pathway and has anti-tumorous activity. Target: Others. Smiles: C[C@H]1CCC\C=C\C(=O)c2c(O)cc(O)cc2CC(=O)O1. References: Xu Y, et al. Characterization of the biosynthetic genes...
| Schlagworte: | 10,11-Dehydrocurvularin |
| CAS | 1095588-70-7 |
| MW: | 290.31 D |
1.440,00 €
