Zu "1085412-37-8" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Pyridostatin
Pyridostatin

Artikelnummer: TGM-T1899-10mg

Description: Pyridostatin (RR82) is a synthetic small-molecule stabilizer of G-quadruplexes, a secondary structure of DNA that usually exists in the end of the chromosome or the telomeres. Target: DNA/RNA Synthesis. Smiles: NCCOc1cc(nc(c1)C(=O)Nc1cc(OCCN)c2ccccc2n1)C(=O)Nc1cc(OCCN)c2ccccc2n1. References: Koirala D,...
Schlagworte: RR82, Pyridostatin Trifluoroacetate Salt
CAS 1085412-37-8
MW: 596.64 D
ab 37,00 €
Bewerten
Pyridostatin Hydrochloride
Pyridostatin Hydrochloride

Artikelnummer: LKT-P9870.1

G-quadruplex ligand, DNA breakage inducer.
Schlagworte: Pyridostatin Trihydrochloride
Anwendung: G-quadruplex ligand, DNA breakage inducer
CAS 1085412-37-8
MW: 896.3 D
ab 135,00 €
Bewerten