Zu "104227-87-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Famciclovir
Artikelnummer: Cay23834-25
Famciclovir is an orally bioavailable prodrug form of the antiviral guanosine analog penciclovir (Cay-22918). Famciclovir is rapidly deacetylated and oxidized in vivo to form penciclovir, which is active against clinical isolates of herpes simplex virus 1 (HSV-1), HSV-2, and varicella-zoster virus (VZV) in a plaque...
| Schlagworte: | BRL 42810, 2-[2-(2-amino-9H-purin-9-yl)ethyl]-1,3-propanediol, 1,3-diacetate |
| Anwendung: | Antiviral agent |
| CAS | 104227-87-4 |
| MW: | 321.3 D |
ab 49,00 €
Famciclovir
Artikelnummer: LKT-F0048.50
An antiviral agent that is an ester of penciclovir and has improved absorption.
| Anwendung: | Antiviral agent |
| Spezies-Reaktivität: | human, mouse |
| CAS | 104227-87-4 |
ab 141,00 €
Famciclovir
Artikelnummer: TGM-T1646-100mg
Description: Famciclovir (BRL 42810) is a Herpes Simplex Virus Nucleoside Analog DNA Polymerase Inhibitor. The mechanism of action of famciclovir is as a DNA Polymerase Inhibitor, and DNA Polymerase Inhibitor. Target: DNA/RNA Synthesis, HSV. Smiles: CC(=O)OCC(CCN1C=NC2=C1N=C(N)N=C2)COC(C)=O. References:...
| Schlagworte: | BRL 42810 |
| Anwendung: | Targets Herpesviridae DNA polymerase catalytic subunit [EC:2.7.7.7] (UL30, UL54, BALF5, U38) |
| CAS | 104227-87-4 |
| MW: | 321.33 D |
ab 30,00 €
