Zu "1034895-42-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
9-ING-41
Artikelnummer: Cay36629-1
9-ING-41 is an inhibitor of glycogen synthase kinase 3beta (GSK3beta, IC50 = 0.71 µM). It inhibits the growth of MiaPaCa-2, BxPC-3, and HuP-T3 pancreatic cancer cells (IC50s = 5, 1, and 0.6 µM, respectively). 9-ING-41 (5 µM) inhibits GSK3beta phosphorylation and induces apoptosis in BxPC-3 and HuP-T3 cells. In vivo,...
| Schlagworte: | Elraglusib, 3-(5-fluoro-3-benzofuranyl)-4-(5-methyl-5H-1,3-dioxolo[4,5-f]indol-7-yl)-1H-pyrrole-2,5-dione |
| Anwendung: | GSK3beta inhibitor |
| CAS | 1034895-42-5 |
| MW: | 404.4 D |
ab 50,00 €
9-ING-41
Artikelnummer: TGM-T14066-100mg
Description: 9-ING-41 is a glycogen synthase kinase-3 inhibitor. Target: Autophagy, GSK-3, Apoptosis. Smiles: Cn1cc(C2=C(C(=O)NC2=O)c2coc3ccc(F)cc23)c2cc3OCOc3cc12. References: Ugolkov AV, et al. 9-ING-41, a small-molecule glycogen synthase kinase-3 inhibitor, is active in neuroblastoma. Anticancer Drugs. 2018...
| Anwendung: | Targets glycogen synthase kinase 3 beta [EC:2.7.11.26] (GSK3B) |
| CAS | 1034895-42-5 |
| MW: | 404.35 D |
ab 43,00 €
