Zu "1032822-42-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PTIQ
Artikelnummer: Cay33540-100
PTIQ is a neuroprotective compound. It inhibits tetrahydro-L-biopterin-induced cytotoxicity and increases in matrix metalloproteinase-3 (MMP-3) levels in CATH.a cells (IC50s = 1.8 and 0.06 µM, respectively). PTIQ inhibits LPS-induced production of MMP-3, TNF-alpha, and COX-2 in BV-2 microglia (IC50s = 2.4, 6.5, and...
| Schlagworte: | 1-(3,4-dihydro-7-hydroxy-6-methoxy-2(1H)-isoquinolinyl)-1-propanone |
| Anwendung: | Neuroprotective compound |
| CAS | 1032822-42-6 |
| MW: | 235.3 D |
ab 147,00 €
PTIQ
Artikelnummer: TGM-T23206-100mg
Description: MMP-3 expression inhibitor. Target: Others. Smiles: O(C)C=1C=C2C(CN(C(CC)=O)CC2)=CC1O
| Anwendung: | Neuroprotective compound |
| CAS | 1032822-42-6 |
| MW: | 235.28 D |
ab 234,00 €
