Zu "1031-07-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Endosulfan sulfate
Artikelnummer: TGM-T19308-100mg
Description: Endosulfan sulfate is a highly toxic and persistent compound that serves as the primary metabolite of the insecticide Endosulfan, which is extensively utilized for various crops. Target: Others. Smiles: O=S1(=O)OCC2C(CO1)C3(Cl)C(Cl)=C(Cl)C2(Cl)C3(Cl)Cl. References: Lee, H., et al. X-ray crystal...
| CAS | 1031-07-8 |
| MW: | 422.93 D |
ab 122,00 €
Endosulfan sulfate
Artikelnummer: Cay24255-50
Endosulfan sulfate is a major metabolite of endosulfan, a broad-spectrum organochlorine insecticide. Endosulfan sulfate is formed through oxidation of endosulfan by bacteria and fungi in the environment, where it is considered a persistent organic pollutant (POP). It accumulates in the liver and gonads of wild...
| Schlagworte: | Endosulfan III, 6,7,8,9,10,10-hexachloro-1,5,5a,6,9,9a-hexahydro-6,9-methano-2,4,3-benzodioxathiepin, 3,3-dioxide |
| Anwendung: | Organochlorine insecticide metabolite, persistent organic pollutant (POP) |
| CAS | 1031-07-8 |
| MW: | 422.9 D |
ab 67,00 €
