Zu "10302-78-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2',3',5'-triacetyl-5-Azacytidine
Artikelnummer: Cay13373-5
2',3',5'-triacetyl-5-Azacytidine is a prodrug form of the DNA methyltransferase inhibitor 5-azacytidine (Cay-11164). It decreases promoter methylation of P15 in L1210 mouse leukemia cells when used at concentrations of 1 and 100 µM. 2',3',5'-triacetyl-5-Azacytidine (10 µM) reduces HIV-1 infection in, and increases...
| Schlagworte: | 4-amino-1-(2,3,5-tri-O-acetyl-beta-D-ribofuranosyl)-1,3,5-triazin-2(1H)-one |
| Anwendung: | DNA methyltransferase inhibitor |
| CAS | 10302-78-0 |
| MW: | 370.3 D |
ab 97,00 €
2',3',5'-triacetyl-5-Azacytidine
Artikelnummer: TGM-T7840-100mg
Description: 2',3',5'-triacetyl-5-Azacytidine (Nsc291930) is a prodrug form of 5-azacytidine that may be rapidly absorbed orally. Target: DNA Methyltransferase. Smiles: CC(=O)OC[C@H]1O[C@H]([C@H](OC(C)=O)[C@@H]1OC(C)=O)n1cnc(N)nc1=O. References: Brueckner, B. Epigenetic Reactivation of Tumor Suppressor Genes by a...
| Schlagworte: | Nsc291930 |
| Anwendung: | DNA methyltransferase inhibitor |
| CAS | 10302-78-0 |
| MW: | 370.31 D |
ab 33,00 €
