Zu "102281-45-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-4-Aminophe
Artikelnummer: CSB-DT3206.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 102281-45-8 |
| MW: | 180.207 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
4-Amino-D-phenylalanine
Artikelnummer: Cay41971-1
A synthetic amino acid and building block, has been used in the synthesis of CXCR4 antagonists. Formulation: A solid. InChI: InChI=1S/C9H12N2O2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,10-11H2,(H,12,13)/t8-/m1/s1. InChIKey: CMUHFUGDYMFHEI-MRVPVSSYSA-N. SMILES: OC([C@H](N)CC1=CC=C(C=C1)N)=O
| Schlagworte: | 4-NH2-D-Phe, p-Amino-D-phenylalanine, para-Amino-D-phenylalanine, (R)-2-amino-3-(4-aminophenyl)propanoic acid |
| Anwendung: | Synthetic amino acid, building block |
| CAS | 102281-45-8 |
| MW: | 180.2 D |
ab 132,00 €
