Zu "1021868-76-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Lorglumide sodium salt
Artikelnummer: TGM-T11868-10mg
Description: Lorglumide sodium salt (CR-1409 sodium salt) is an antagonist of cholecystokinin receptors (CCK). Target: cholecystokinin. Smiles: CCCCCN(C(C(NC(C1=CC(Cl)=C(Cl)C=C1)=O)CCC([O-])=O)=O)CCCCC.[Na+]. References: Scarpignato C, et al. Effect of a new potent CCK antagonist, lorglumide, on caerulein- and...
| Schlagworte: | CR-1409 sodium salt |
| Anwendung: | CCK1-R antagonist |
| CAS | 1021868-76-7 |
| MW: | 481.39 D |
ab 30,00 €
Lorglumide (sodium salt)
Artikelnummer: Cay17555-10
Cholecystokinin (CCK) is a peptide hormone that, through specific receptors, induces pancreatic growth and enzyme secretion, smooth muscle contraction in the gall bladder and stomach, and modulates feeding and behavior. Lorglumide is a nonpeptidic antagonist of the CCK A receptor (CCK1, IC50 = 50 nM) that is 60-fold...
| Schlagworte: | 4-[(3,4-dichlorobenzoyl)amino]-5-(dipentylamino)-5-oxo-pentanoic acid, monosodium salt |
| Anwendung: | CCK1-R antagonist |
| CAS | 1021868-76-7 |
| MW: | 481.4 D |
ab 44,00 €
