Zu "101199-38-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PTZ-343
Artikelnummer: Cay22908-500
PTZ-343 is a water-soluble enhancer of luminol (Cay-16803) chemiluminescent peroxidation catalyzed by horseradish peroxidase (HRP). It acts as an electron transfer mediator, reacting with HRP-II to release HRP and a PTZ-343 radical, which oxidizes luminol anions to induce light emission. HRP-induced chemiluminescent...
| Schlagworte: | 10H-phenothiazine-10-propanesulfonic acid, monosodium salt |
| Anwendung: | Chemiluminescence, water-soluble luminol enhancer |
| CAS | 101199-38-6 |
| MW: | 343.4 D |
ab 93,00 €
PTZ-343
Artikelnummer: TGM-T21343-100mg
Description: PTZ-343 is a potent enhancer of Luminol, acting as an electron transfer mediator. It reacts with HRP-II to release HRP and a PTZ-343 radical, which then oxidizes luminol anions to induce light emission. Target: Others. Smiles: [Na+].[O-]S(=O)(=O)CCCN1c2ccccc2Sc2ccccc12. References: WenxiaZhang, et al. A...
| Schlagworte: | PTZ 343, PTZ-343 sodium |
| CAS | 101199-38-6 |
| MW: | 343.39 D |
ab 30,00 €
