Zu "101140-06-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
3,8'-Biapigenin
Artikelnummer: Cay34143-1
3,8'-Biapigenin is a polyketide synthase-derived biflavonoid that has been found in Hypericum and has diverse biological activities. It inhibits protein tyrosine phosphatase 1B (PTP1B, IC50 = 4.5 µM) and stimulates glucose uptake in 3T3-L1 adipocyte cells when used at concentrations of 5 and 10 µM. 3,8'-Biapigenin...
| Schlagworte: | 3,8"-Biapigenin, I3,II8-Biapigenin, 5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-[3,8'-bi-4H-1-benzopyran]-4,4'-dione |
| Anwendung: | Bioactive biflavonoid, PTP1B inhibitor |
| CAS | 101140-06-1 |
| MW: | 538.5 D |
ab 93,00 €
3,8''-Biapigenin
Artikelnummer: TGM-TN1241-1mg
Description: 3, 8''-Biapigenin can modulate intracellular ROS production. Target: ROS. Smiles: Oc(cc1)ccc1C(Oc(c1c(cc2O)O)c2C2=C(c(cc3)ccc3O)Oc(cc(cc3O)O)c3C2=O)=CC1=O. References: Cellular reactive oxygen species inhibitory constituents of Hypericum thasium Griseb.Phytochemistry. 2009 Jan,70(2):244-9.
| Schlagworte: | 3,8'-Biapigenin |
| CAS | 101140-06-1 |
| MW: | 538.46 D |
210,00 €
