Zu "100646-51-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Quizalofop-p-ethyl
Artikelnummer: CDX-Q0024-G001
Quizalofop-p-ethyl is a post-emergence herbicide that finds applications in annual and perennial weed control management. Quizalofop-p-ethyl acts as a selective post-emergence herbicide that targets the enzyme acetyl-CoA carboxylase (ACC), for fatty acid synthesis in plants. Consequently, Quizalofop-p-ethyl...
| Schlagworte: | Quinofop-ethyl, DPX-Y6202, Ethyl (R)-2-[4-(6-chloro-2-quinoxalyloxy)phenoxy]propionate |
| Anwendung: | Post-emergence herbicide, acetyl-CoA carboxylase (ACC) inhibitor |
| CAS | 100646-51-3 |
| MW: | 372,8 D |
ab 138,00 €
Quizalofop-p-ethyl
Artikelnummer: TGM-T19537-100mg
Description: Quizalofop-p-ethyl ((R)-Quizalofop ethyl) is a selective post-emergent herbicide for use on annual and perennial weeds, acting as an acetyl-CoA carboxylase (ACCase) inhibitor leading to weed death. Target: Acetyl-CoA Carboxylase, Others. Smiles: O(C1=NC2=C(N=C1)C=C(Cl)C=C2)C3=CC=C(O[C@@H](C(OCC)=O)C)C=C3
| Schlagworte: | (R)-Quizalofop ethyl , Quinofop-ethyl |
| CAS | 100646-51-3 |
| MW: | 372.8 D |
ab 35,00 €
