Zu "1005342-46-0" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
LCL161
Artikelnummer: TGM-T2080-100mg
Description: LCL161, a SMAC mimetic, effectivity binds to and inhibits multiple IAPs (i.e. XIAP, c-IAP). Target: IAP. Smiles: CNC(C)C(=O)NC(C1CCCCC1)C(=O)N1CCCC1c1nc(cs1)C(=O)c1ccc(F)cc1. References: Weisberg E, et al. Leukemia, 2010, 24(12), 2100-2109.
| CAS | 1005342-46-0 |
| MW: | 500.63 D |
ab 62,00 €
LCL-161
Artikelnummer: Cay22420-5
LCL-161 is a small molecule Smac mimetic that inhibits multiple inhibitor of apoptosis (IAP) family proteins. As a single agent, LCL-161 inhibits growth of FLT3-ITD-expressing leukemia cells via induction of apoptosis with IC50 values ranging from 0.5-4 µM. In vivo, LCL-161 enhances growth inhibition driven by PKC...
| Schlagworte: | NVP-LCL161,... |
| Anwendung: | DIABLO / SMAC mimetic, IAP inhibitor |
| CAS | 1005342-46-0 |
| MW: | 500.6 D |
ab 219,00 €
LCL-161
Artikelnummer: LKT-L1044.1
SMAC mimetic, PXR agonist, IAP inhibitor.
| Schlagworte: | LCL161 |
| Anwendung: | DIABLO / SMAC mimetic, IAP inhibitor |
| CAS | 1005342-46-0 |
| MW: | 500.63 D |
ab 121,00 €
LCL-161
Artikelnummer: BPS-82073
LCL-161 is a small molecule Smac mimetic that inhibits multiple inhibitors of apoptosis (IAP) family proteins.
| Schlagworte: | LCL161, LCL 161, |
| Anwendung: | Smac mimetic, IAP inhibitor |
| CAS | 1005342-46-0 |
| MW: | 500,9 D |
859,00 €
