Zu "1002789-86-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TZ9
Artikelnummer: Cay15964-1
TZ9 is a cell-permeable triazine compound that inhibits the human E2 ubiquitin-conjugating enzyme Rad6B. TZ9 selectively docks to the Rad6B catalytic site, inhibits Rad6B-induced histone H2A ubiquitination, downregulates intracellular beta-catenin, induces G2/M arrest and apoptosis, and inhibits proliferation and...
| Schlagworte: | 4-amino-6-(phenylamino)-2-(4-nitrobenzoate)-1,3,5-triazine-2-methanol |
| Anwendung: | Cell-permeable UBE2B / Rad6B inhibitor |
| CAS | 1002789-86-7 |
| MW: | 366.3 D |
ab 52,00 €
TZ9
Artikelnummer: TGM-T17187-10mg
Description: TZ9 is a selective and potent Rad6 inhibitor with anticancer and anti-tumor activity.TZ9 inhibits Rad6B-induced ubiquitination of histone H2A.TZ9 induces cell cycle arrest and apoptosis. Target: Apoptosis, E1/E2/E3 Enzyme. Smiles: Nc1nc(COC(=O)c2ccc(cc2)[N+]([O-])=O)nc(Nc2ccccc2)n1. References: Sanders...
| Anwendung: | Cell-permeable UBE2B / Rad6B inhibitor |
| CAS | 1002789-86-7 |
| MW: | 366.33 D |
ab 44,00 €
