3-hydroxy Palmitic Acid

3-hydroxy Palmitic acid is a form of the 16:0 lipid palmitic acid (Cay-10006627). The lipid A part of lipopolysaccharides contain various 3-hydroxy fatty acids, making oxylipins such as 3-hydroxy palmitic acid useful as chemical markers of endotoxins. In R. solanacearum, 3-hydroxy palmitic acid is converted by an S-adenosyl methionine-dependent methyltransferase to 3-hydroxy palmitic acid methyl ester, which acts as a quorum sensing signal molecule for post-transcriptional modulation of genes involved in virulence. Long-chain 3-hydroxy fatty acids, such as 3-hydroxy palmitic acid, are also known to accumulate during long-chain 3-hydroxy-acyl-CoA dehydrogenase and mitochondrial trifunctional protein deficiencies. Such accumulation induces oxidative stress, leading to mitochondrial bioenergetics deregulation and eventual multi-organ dysfunction.Formal Name: 3-hydroxy-hexadecanoic acid. CAS Number: 2398-34-7. Synonyms: FA 16:0,O, beta-hydroxy Hexadecanoic Acid, beta-hydroxy Palmitic Acid, DL-3-hydroxy Palmitic Acid. Molecular Formula: C16H32O3. Formula Weight: 272.4. Purity: >95%. Formulation: (Request formulation change), A crystalline solid. Solubility: DMF: 20 mg/ml, DMSO: 20 mg/ml, DMSO:PBS (pH 7.2) (1:2): 0.33 mg/ml, Ethanol: 2.5 mg/ml. SMILES: CCCCCCCCCCCCCC(O)CC(O)=O. InChi Code: InChI=1S/C16H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-15(17)14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19). InChi Key: CBWALJHXHCJYTE-UHFFFAOYSA-N.