Toosendanin

Description: 1. Toosendanin possesses hepatotoxicity. 2. Toosendanin has effects on the growth, cell cycle arrest, induction of apoptosis and the involved signaling pathway in human promyelocytic leukemia HL-6 cells. 3. Toosendanin is an effective insecticide for Ae. Target: Others. Smiles: CC(=O)O[C@@H]1C[C@H](O)[C@@]23CO[C@@H](O)[C@]1(C)[C@@H]2C[C@@H](O)[C@]1(C)[C@@H]3C(=O)[C@H](OC(C)=O)[C@@]2(C)[C@@H](C[C@H]3O[C@@]123)c1ccoc1. References: Shi Y L , Li M F . Biological effects of toosendanin, a triterpenoid extracted from Chinese traditional medicine[J]. Progress in Neurobiology, 2007, 82(1):1-10.