TFAX 594,SE

Description: TFAX 594,SE is a red fluorescent dye that maintains its fluorescence properties across a pH range of 4 to 10. It produces highly intense and photostable conjugates when bound to proteins or antibodies, such as [goat anti-mouse IgG]. Smiles: CN1c2cc3Oc4cc5=[N+](C)C(C)(C)C=C(CS([O-])(=O)=O)c5cc4=C(c4ccc(cc4C(O)=O)C(=O)ON4C(=O)CCC4=O)c3cc2C(CS(O)(=O)=O)=CC1(C)C. References: Panchuk-Voloshina N, et al. Alexa dyes, a series of new fluorescent dyes that yield exceptionally bright, photostable conjugates. J Histochem Cytochem. 1999,47(9):1179-1188.