Spongosine

A nucleoside with diverse biological activities, antagonist of adenosine A1, A2A, and A3 receptors (Kis = 155, 970, and 156 nM, respectively, in CHO cells expressing the human receptors), inhibits collagen-induced platelet aggregation in isolated human whole blood and platelet-rich plasma at 100 µM, decreases contractile force and frequency in spontaneously contracting isolated guinea pig atrial muscles (EC50s = 32.7 and 127.7 µM, respectively). Formulation: A solid. InChI: InChI=1S/C11H15N5O5/c1-20-11-14-8(12)5-9(15-11)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7-,10-/m1/s1. InChIKey: AJACDNCVEGIBNA-KQYNXXCUSA-N. SMILES: O[C@H]1[C@@H](O[C@@H]([C@H]1O)CO)N2C3=NC(OC)=NC(N)=C3N=C2