SNOB 1 Reagent

Description: SNOB 1 Reagent is a biotinylated probe for detecting S-nitrosylated proteins in a single step. S-Nitrosylated binding (SNOB) proceeds rapidly on surface proteins or cell lysates under normal physiological conditions. Proteins tagged with SNOB 1 Reagent can be analyzed using avidin-linked probes (e.g., by immunoblot) or by mass spectrometry. Target: Others. Smiles: C(CCCC(NCC=C)=O)[C@H]1[C@@]2([C@@](NC(=O)N2)(CS1)[H])[H]