Schisandrol B

Description: 1. Schisandrol B (Besigomsin) may exert neuroprotective effects by attenuating the microglia-mediated neuroinflammatory response via inhibiting the TLR4-mediated NF-kappaB and MAPKs signaling pathways. 2. Schisandrol B has anti-inflammatory property, potentially result from the inhibition of COX-2, iNOS, IL-6, TNF-alpha and NO through the down-regulation of RIP2 and NF-kappaB activation. 3. Schisandrol B induces marked protective effects against hepatic and renal injury induced by CCl(4) exposure through differential regulation of the MAPK signal transduction pathway. 4. Schisandrol B significantly inhibits cell proliferation in a dose-dependent manner, due to cell cycle arrest in the G1 phase with the downregulation of cyclin D1 expression and Retinoblastoma (RB) phosphorylation. Target: Reactive Oxygen Species, Autophagy, P450. Smiles: COc1cc2CC(C)(O)C(C)Cc3cc4OCOc4c(OC)c3-c2c(OC)c1OC. References: Hwang, Dae. Protective effects of gomisin A isolated from Schisandra chinensis against CCl4-induced hepatic and renal injury[J]. International Journal of Molecular Medicine, 2013, 31(4):888---898.