Phenylacetylglutamine

Description: Phenylacetylglutamine (NSC 203800)is a normal constituent of human urine, but other mammals such as the dog, cat, rat, monkey, sheep, and horse do not excrete this compound. Phenylacetylglutamine is a major nitrogenous metabolite that accumulates in uremia. Phenylacetylglutamine also is a microbial metabolite found in Christensenellaceae, Lachnospiraceae, and Ruminococcaceae. Target: Endogenous Metabolite, Others. Smiles: [C@H](NC(CC1=CC=CC=C1)=O)(CCC(N)=O)C(O)=O. References: Karoum F, et al. Plasma and cerebrospinal fluid concentration of phenylacetic acid in humans and monkeys. J Chromatogr Sci. 1983 Dec,21(12):546-50.