N-Succinimidyl-S-acetylthioacetate

Description: N-Succinimidyl-S-acetylthioacetate (SATA) is a protein modification agent that introduces thiol-groups into protein molecules and adds sulfhydryl groups in a protected form to proteins and other amine-containing molecules for later reaction with sulfhydryl reactive crosslinkers such as Sulfo-SMCC, Sulfo-MBS, etc. Target: Others. Smiles: CC(=O)SCC(=O)ON1C(=O)CCC1=O. References: J.L.M.Heeremans, et al. Interference of epsilon-amino-caproic acid with [N-succinimidyl S-acetylthioacetate derived] thiol-introduction into glu-plasminogen. Volume 8, Supplement 2, 1994, Pages 138-141.