Lauroyl coenzyme A lithium

Description: Lauroyl coenzyme A lithium salt is a type of coenzyme A that acts as an acyl carrier, specifically acetyl-CoA. Lauryl-CoA (C12-CoA) is a long-chain (C-12) saturated fatty acyl-CoA involved in lipid metabolism, lipid biosynthesis, and fatty acid transport. It serves as a substrate for the FAM34A protein and is a product of firefly luciferase. Target: Others. Smiles: [Li+].CCCCCCCCCC CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP([O-])(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)n1cnc2c(N)ncnc12