Larsucosterol Ammonium salt

Description: Larsucosterol ammonium salt is the salt form of Larsucosterol (DUR-928) and a derivative of 25HC3S.Larsucosterol is a DNA methyltransferase inhibitor (DNMT), a potent hepatic X-receptor (LXR) antagonist, an endogenous oxysterol sulfate, and an epigenetic modulator, regulate lipid metabolism, reduce inflammation and treat liver disease. Target: Liver X Receptor, DNA Methyltransferase. Smiles: C[C@@]12[C@](CC[C@]2([H])[C@H](C)CCCC(C)(O)C)([H])[C@@]3([H])[C@@](CC1)([H])[C@@]4(C(C[C@H](CC4)OS(=O)([O-])=O)=CC3)C.[NH4+]