JQ dS-4

Description: JQ dS-4 is a degrader of Brahma-related gene 1 (BRG1)/BRM/SMARCA4 (PROTAC(R), DC50 range = 9 - 390 nM in glioma models and cell lines), featuring a BRG1 inhibitor connected through a linker to a cereblon (CRBN) E3 ligase ligand. It effectively degrades BRG1 completely over 48 and 72 hours in HSJD-DIPG007 and SU-DIPGXIIIP cells. Additionally, it lessens the viability of various cancer cell lines, including those of H3K27M glioma, prostate, thyroid, and salivary gland. Smiles: O=C(NC=1C=CN=C(Cl)C1)NC=2C=CN=C(C#CC3=CC=CC(=C3)C(=O)NCCCCNC4=CC=CC=5C(=O)N(C(=O)C45)C6C(=O)NC(=O)CC6)C2